About 1-methoxythianthrene
1-methoxythianthrene (PubChem CID 5081860) has the molecular formula C13H10OS2
and a molecular weight of 246.36 g/mol. Its IUPAC name is 1-methoxythianthrene.
Molecular Properties
| Compound Name | 1-methoxythianthrene |
| PubChem CID | 5081860 |
| Molecular Formula | C13H10OS2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 1-methoxythianthrene |
| SMILES | COc1cccc2c1Sc1ccccc1S2 |
| InChI | InChI=1S/C13H10OS2/c1-14-9-5-4-8-12-13(9)16-11-7-3-2-6-10(11)15-12/h2-8H,1H3 |
| InChIKey | GOBVYINQRVPRKX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxythianthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxythianthrene?
The IUPAC name of 1-methoxythianthrene (CID 5081860) is 1-methoxythianthrene.
What is the SMILES notation for 1-methoxythianthrene?
The canonical SMILES for 1-methoxythianthrene is COc1cccc2c1Sc1ccccc1S2.
What is the InChIKey of 1-methoxythianthrene?
The InChIKey is GOBVYINQRVPRKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10OS2/c1-14-9-5-4-8-12-13(9)16-11-7-3-2-6-10(11)15-12/h2-8H,1H3.
What are the key properties of 1-methoxythianthrene?
1-methoxythianthrene has a molecular weight of 246.36 g/mol, XLogP of 4.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxythianthrene is sourced from PubChem (CID 5081860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).