About 1-phenoxythianthrene
1-phenoxythianthrene (PubChem CID 19906708) has the molecular formula C18H12OS2
and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-phenoxythianthrene.
Molecular Properties
| Compound Name | 1-phenoxythianthrene |
| PubChem CID | 19906708 |
| Molecular Formula | C18H12OS2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 1-phenoxythianthrene |
| SMILES | c1ccc(Oc2cccc3c2Sc2ccccc2S3)cc1 |
| InChI | InChI=1S/C18H12OS2/c1-2-7-13(8-3-1)19-14-9-6-12-17-18(14)21-16-11-5-4-10-15(16)20-17/h1-12H |
| InChIKey | RVHLEZBKUAPZJL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenoxythianthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxythianthrene?
The IUPAC name of 1-phenoxythianthrene (CID 19906708) is 1-phenoxythianthrene.
What is the SMILES notation for 1-phenoxythianthrene?
The canonical SMILES for 1-phenoxythianthrene is c1ccc(Oc2cccc3c2Sc2ccccc2S3)cc1.
What is the InChIKey of 1-phenoxythianthrene?
The InChIKey is RVHLEZBKUAPZJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12OS2/c1-2-7-13(8-3-1)19-14-9-6-12-17-18(14)21-16-11-5-4-10-15(16)20-17/h1-12H.
What are the key properties of 1-phenoxythianthrene?
1-phenoxythianthrene has a molecular weight of 308.43 g/mol, XLogP of 6.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxythianthrene is sourced from PubChem (CID 19906708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).