About 1-phenylpyrrole
1-phenylpyrrole (PubChem CID 12480) has the molecular formula C10H9N
and a molecular weight of 143.19 g/mol. Its IUPAC name is 1-phenylpyrrole.
Molecular Properties
| Compound Name | 1-phenylpyrrole |
| PubChem CID | 12480 |
| Molecular Formula | C10H9N |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 1-phenylpyrrole |
| SMILES | c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C10H9N/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-9H |
| InChIKey | GEZGAZKEOUKLBR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpyrrole?
The IUPAC name of 1-phenylpyrrole (CID 12480) is 1-phenylpyrrole.
What is the SMILES notation for 1-phenylpyrrole?
The canonical SMILES for 1-phenylpyrrole is c1ccc(-n2cccc2)cc1.
What is the InChIKey of 1-phenylpyrrole?
The InChIKey is GEZGAZKEOUKLBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-9H.
What are the key properties of 1-phenylpyrrole?
1-phenylpyrrole has a molecular weight of 143.19 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpyrrole is sourced from PubChem (CID 12480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).