C18H13BrN2O3 — CID 10000132
2-[(4-bromophenyl)methyl]spiro[isoindole-3,3'-pyrrolidine]-1,2',5'-trione (PubChem CID 10000132) has the molecular formula C18H13BrN2O3 and a molecular weight of 385.22 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]spiro[isoindole-3,3'-pyrrolidine]-1,2',5'-trione.
| Compound Name | 2-[(4-bromophenyl)methyl]spiro[isoindole-3,3'-pyrrolidine]-1,2',5'-trione |
|---|---|
| PubChem CID | 10000132 |
| Molecular Formula | C18H13BrN2O3 |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]spiro[isoindole-3,3'-pyrrolidine]-1,2',5'-trione |
| SMILES | O=C1CC2(C(=O)N1)c1ccccc1C(=O)N2Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H13BrN2O3/c19-12-7-5-11(6-8-12)10-21-16(23)13-3-1-2-4-14(13)18(21)9-15(22)20-17(18)24/h1-8H,9-10H2,(H,20,22,24) |
| InChIKey | YYCOTDIZDQHPKL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|