C24H38O4 — CID 10000481
(4R,8E,10S,11R,12E,14R)-10-hydroxy-14-[(E,1R,2R)-1-hydroxy-2-methylhept-3-enyl]-4,11-dimethyl-5-methylidene-1-oxacyclotetradeca-8,12-dien-2-one (PubChem CID 10000481) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is (4R,8E,10S,11R,12E,14R)-10-hydroxy-14-[(E,1R,2R)-1-hydroxy-2-methylhept-3-enyl]-4,11-dimethyl-5-methylidene-1-oxacyclotetradeca-8,12-dien-2-one.
| Compound Name | (4R,8E,10S,11R,12E,14R)-10-hydroxy-14-[(E,1R,2R)-1-hydroxy-2-methylhept-3-enyl]-4,11-dimethyl-5-methylidene-1-oxacyclotetradeca-8,12-dien-2-one |
|---|---|
| PubChem CID | 10000481 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (4R,8E,10S,11R,12E,14R)-10-hydroxy-14-[(E,1R,2R)-1-hydroxy-2-methylhept-3-enyl]-4,11-dimethyl-5-methylidene-1-oxacyclotetradeca-8,12-dien-2-one |
| SMILES | C=C1CC/C=C/[C@H](O)[C@H](C)/C=C/[C@H]([C@H](O)[C@H](C)/C=C/CCC)OC(=O)C[C@H]1C |
| InChI | InChI=1S/C24H38O4/c1-6-7-8-12-19(4)24(27)22-15-14-18(3)21(25)13-10-9-11-17(2)20(5)16-23(26)28-22/h8,10,12-15,18-22,24-25,27H,2,6-7,9,11,16H2,1,3-5H3/b12-8+,13-10+,15-14+/t18-,19-,20-,21+,22-,24-/m1/s1 |
| InChIKey | YYLMDSJRCIURAD-YAQNPAFLSA-N |
| XLogP | 4.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|