C18H25ClN6O2 — CID 10000619
4-N-(7-aminoheptyl)-2-N-[(2-chlorophenyl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 10000619) has the molecular formula C18H25ClN6O2 and a molecular weight of 392.89 g/mol. Its IUPAC name is 4-N-(7-aminoheptyl)-2-N-[(2-chlorophenyl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-(7-aminoheptyl)-2-N-[(2-chlorophenyl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 10000619 |
| Molecular Formula | C18H25ClN6O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-N-(7-aminoheptyl)-2-N-[(2-chlorophenyl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | NCCCCCCCNc1nc(NCc2ccccc2Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H25ClN6O2/c19-15-9-5-4-8-14(15)12-22-18-23-13-16(25(26)27)17(24-18)21-11-7-3-1-2-6-10-20/h4-5,8-9,13H,1-3,6-7,10-12,20H2,(H2,21,22,23,24) |
| InChIKey | ZHRPDCBTUCUNAX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|