C18H17Cl2N3O3 — CID 10000692
(2R,4S)-5,7-dichloro-4-[(4-methylphenyl)carbamoylamino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid (PubChem CID 10000692) has the molecular formula C18H17Cl2N3O3 and a molecular weight of 394.26 g/mol. Its IUPAC name is (2R,4S)-5,7-dichloro-4-[(4-methylphenyl)carbamoylamino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid.
| Compound Name | (2R,4S)-5,7-dichloro-4-[(4-methylphenyl)carbamoylamino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 10000692 |
| Molecular Formula | C18H17Cl2N3O3 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (2R,4S)-5,7-dichloro-4-[(4-methylphenyl)carbamoylamino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)N[C@H]2C[C@H](C(=O)O)Nc3cc(Cl)cc(Cl)c32)cc1 |
| InChI | InChI=1S/C18H17Cl2N3O3/c1-9-2-4-11(5-3-9)21-18(26)23-14-8-15(17(24)25)22-13-7-10(19)6-12(20)16(13)14/h2-7,14-15,22H,8H2,1H3,(H,24,25)(H2,21,23,26)/t14-,15+/m0/s1 |
| InChIKey | SPFYQISIAZRTPO-LSDHHAIUSA-N |
| XLogP | 4.43 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |