C24H30N2O3 — CID 10000728
3-methoxy-N-[(E)-2-methyl-3-phenylprop-2-enyl]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 10000728) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 3-methoxy-N-[(E)-2-methyl-3-phenylprop-2-enyl]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 3-methoxy-N-[(E)-2-methyl-3-phenylprop-2-enyl]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 10000728 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 3-methoxy-N-[(E)-2-methyl-3-phenylprop-2-enyl]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | COc1cccc(C(=O)N(CCN2CCOCC2)C/C(C)=C/c2ccccc2)c1 |
| InChI | InChI=1S/C24H30N2O3/c1-20(17-21-7-4-3-5-8-21)19-26(12-11-25-13-15-29-16-14-25)24(27)22-9-6-10-23(18-22)28-2/h3-10,17-18H,11-16,19H2,1-2H3/b20-17+ |
| InChIKey | XQVCKPPHXLIRJG-LVZFUZTISA-N |
| XLogP | 3.57 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |