About 3-cyclohexyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide
3-cyclohexyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide (PubChem CID 10000753) has the molecular formula C19H20Cl2N2O3
and a molecular weight of 395.29 g/mol. Its IUPAC name is 3-cyclohexyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide.
Molecular Properties
| Compound Name | 3-cyclohexyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide |
| PubChem CID | 10000753 |
| Molecular Formula | C19H20Cl2N2O3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 3-cyclohexyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)cncc2Cl)cc1OC1CCCCC1 |
| InChI | InChI=1S/C19H20Cl2N2O3/c1-25-16-8-7-12(9-17(16)26-13-5-3-2-4-6-13)19(24)23-18-14(20)10-22-11-15(18)21/h7-11,13H,2-6H2,1H3,(H,22,23,24) |
| InChIKey | KXUOLBNFVWOTRY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclohexyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide?
The IUPAC name of 3-cyclohexyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide (CID 10000753) is 3-cyclohexyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide.
What is the SMILES notation for 3-cyclohexyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide?
The canonical SMILES for 3-cyclohexyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide is COc1ccc(C(=O)Nc2c(Cl)cncc2Cl)cc1OC1CCCCC1.
What is the InChIKey of 3-cyclohexyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide?
The InChIKey is KXUOLBNFVWOTRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Cl2N2O3/c1-25-16-8-7-12(9-17(16)26-13-5-3-2-4-6-13)19(24)23-18-14(20)10-22-11-15(18)21/h7-11,13H,2-6H2,1H3,(H,22,23,24).
What are the key properties of 3-cyclohexyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide?
3-cyclohexyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide has a molecular weight of 395.29 g/mol, XLogP of 5.36, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide is sourced from PubChem (CID 10000753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).