About 4-fluoro-5,6-diiodo-2-methylsulfanylpyrimidine
4-fluoro-5,6-diiodo-2-methylsulfanylpyrimidine (PubChem CID 10000796) has the molecular formula C5H3FI2N2S
and a molecular weight of 395.97 g/mol. Its IUPAC name is 4-fluoro-5,6-diiodo-2-methylsulfanylpyrimidine.
Molecular Properties
| Compound Name | 4-fluoro-5,6-diiodo-2-methylsulfanylpyrimidine |
| PubChem CID | 10000796 |
| Molecular Formula | C5H3FI2N2S |
| Molecular Weight | 395.97 g/mol |
| Exact Mass | 395.81 |
| IUPAC Name | 4-fluoro-5,6-diiodo-2-methylsulfanylpyrimidine |
| SMILES | CSc1nc(F)c(I)c(I)n1 |
| InChI | InChI=1S/C5H3FI2N2S/c1-11-5-9-3(6)2(7)4(8)10-5/h1H3 |
| InChIKey | VPPSYPBAAZFSGP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.97 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-5,6-diiodo-2-methylsulfanylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-5,6-diiodo-2-methylsulfanylpyrimidine?
The IUPAC name of 4-fluoro-5,6-diiodo-2-methylsulfanylpyrimidine (CID 10000796) is 4-fluoro-5,6-diiodo-2-methylsulfanylpyrimidine.
What is the SMILES notation for 4-fluoro-5,6-diiodo-2-methylsulfanylpyrimidine?
The canonical SMILES for 4-fluoro-5,6-diiodo-2-methylsulfanylpyrimidine is CSc1nc(F)c(I)c(I)n1.
What is the InChIKey of 4-fluoro-5,6-diiodo-2-methylsulfanylpyrimidine?
The InChIKey is VPPSYPBAAZFSGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3FI2N2S/c1-11-5-9-3(6)2(7)4(8)10-5/h1H3.
What are the key properties of 4-fluoro-5,6-diiodo-2-methylsulfanylpyrimidine?
4-fluoro-5,6-diiodo-2-methylsulfanylpyrimidine has a molecular weight of 395.97 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-5,6-diiodo-2-methylsulfanylpyrimidine is sourced from PubChem (CID 10000796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).