C24H19N3O3 — CID 10000872
3-[1-(3-hydroxypropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-naphthalen-1-ylpyrrole-2,5-dione (PubChem CID 10000872) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is 3-[1-(3-hydroxypropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-naphthalen-1-ylpyrrole-2,5-dione.
| Compound Name | 3-[1-(3-hydroxypropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-naphthalen-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 10000872 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 3-[1-(3-hydroxypropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-naphthalen-1-ylpyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CCCO)c3ncccc23)=C1c1cccc2ccccc12 |
| InChI | InChI=1S/C24H19N3O3/c28-13-5-12-27-14-19(18-10-4-11-25-22(18)27)21-20(23(29)26-24(21)30)17-9-3-7-15-6-1-2-8-16(15)17/h1-4,6-11,14,28H,5,12-13H2,(H,26,29,30) |
| InChIKey | RLESTJQOEHIBLM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|