C24H28N4O2 — CID 10001274
[4-(3,4-dimethylphenyl)piperazin-1-yl]-[2-(4-methoxyphenyl)-5-methylpyrazol-3-yl]methanone (PubChem CID 10001274) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is [4-(3,4-dimethylphenyl)piperazin-1-yl]-[2-(4-methoxyphenyl)-5-methylpyrazol-3-yl]methanone.
| Compound Name | [4-(3,4-dimethylphenyl)piperazin-1-yl]-[2-(4-methoxyphenyl)-5-methylpyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 10001274 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | [4-(3,4-dimethylphenyl)piperazin-1-yl]-[2-(4-methoxyphenyl)-5-methylpyrazol-3-yl]methanone |
| SMILES | COc1ccc(-n2nc(C)cc2C(=O)N2CCN(c3ccc(C)c(C)c3)CC2)cc1 |
| InChI | InChI=1S/C24H28N4O2/c1-17-5-6-21(15-18(17)2)26-11-13-27(14-12-26)24(29)23-16-19(3)25-28(23)20-7-9-22(30-4)10-8-20/h5-10,15-16H,11-14H2,1-4H3 |
| InChIKey | SWFUAPQSAOUKRS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|