C23H23N3O4 — CID 10001334
methyl 2-[4-[[[3-[(2-methoxyacetyl)amino]-2-pyridinyl]amino]methyl]phenyl]benzoate (PubChem CID 10001334) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is methyl 2-[4-[[[3-[(2-methoxyacetyl)amino]-2-pyridinyl]amino]methyl]phenyl]benzoate.
| Compound Name | methyl 2-[4-[[[3-[(2-methoxyacetyl)amino]-2-pyridinyl]amino]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 10001334 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | methyl 2-[4-[[[3-[(2-methoxyacetyl)amino]-2-pyridinyl]amino]methyl]phenyl]benzoate |
| SMILES | COCC(=O)Nc1cccnc1NCc1ccc(-c2ccccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C23H23N3O4/c1-29-15-21(27)26-20-8-5-13-24-22(20)25-14-16-9-11-17(12-10-16)18-6-3-4-7-19(18)23(28)30-2/h3-13H,14-15H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | ZLYBATPQQQIGSX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |