C27H37NO2 — CID 10001458
(1S,4aS,10aR)-N-(2-adamantyl)-6-hydroxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide (PubChem CID 10001458) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is (1S,4aS,10aR)-N-(2-adamantyl)-6-hydroxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide.
| Compound Name | (1S,4aS,10aR)-N-(2-adamantyl)-6-hydroxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 10001458 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | (1S,4aS,10aR)-N-(2-adamantyl)-6-hydroxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
| SMILES | C[C@]1(C(=O)NC2C3CC4CC(C3)CC2C4)CCC[C@]2(C)c3cc(O)ccc3CC[C@@H]12 |
| InChI | InChI=1S/C27H37NO2/c1-26-8-3-9-27(2,23(26)7-5-18-4-6-21(29)15-22(18)26)25(30)28-24-19-11-16-10-17(13-19)14-20(24)12-16/h4,6,15-17,19-20,23-24,29H,3,5,7-14H2,1-2H3,(H,28,30)/t16?,17?,19?,20?,23-,24?,26-,27+/m1/s1 |
| InChIKey | GBNHOQWDXVLAFY-SRYDNDORSA-N |
| XLogP | 5.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |