C24H40O5 — CID 10001517
methyl (5Z,8Z)-9-[(4R,5R)-5-[(Z,1R)-1-hydroxynon-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]nona-5,8-dienoate (PubChem CID 10001517) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is methyl (5Z,8Z)-9-[(4R,5R)-5-[(Z,1R)-1-hydroxynon-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]nona-5,8-dienoate.
| Compound Name | methyl (5Z,8Z)-9-[(4R,5R)-5-[(Z,1R)-1-hydroxynon-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]nona-5,8-dienoate |
|---|---|
| PubChem CID | 10001517 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | methyl (5Z,8Z)-9-[(4R,5R)-5-[(Z,1R)-1-hydroxynon-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]nona-5,8-dienoate |
| SMILES | CCCCC/C=C\C[C@@H](O)[C@H]1OC(C)(C)O[C@@H]1/C=C\C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C24H40O5/c1-5-6-7-8-11-14-17-20(25)23-21(28-24(2,3)29-23)18-15-12-9-10-13-16-19-22(26)27-4/h9-11,14-15,18,20-21,23,25H,5-8,12-13,16-17,19H2,1-4H3/b10-9-,14-11-,18-15-/t20-,21-,23-/m1/s1 |
| InChIKey | HRAAYYUREXLKRO-FEVVRKBWSA-N |
| XLogP | 5.24 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|