C23H39NO5 — CID 10001564
tert-butyl N-[(2S,3S)-1-cyclohexyl-3-(oxan-2-yloxy)-5-oxohept-6-en-2-yl]carbamate (PubChem CID 10001564) has the molecular formula C23H39NO5 and a molecular weight of 409.57 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-1-cyclohexyl-3-(oxan-2-yloxy)-5-oxohept-6-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-1-cyclohexyl-3-(oxan-2-yloxy)-5-oxohept-6-en-2-yl]carbamate |
|---|---|
| PubChem CID | 10001564 |
| Molecular Formula | C23H39NO5 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | tert-butyl N-[(2S,3S)-1-cyclohexyl-3-(oxan-2-yloxy)-5-oxohept-6-en-2-yl]carbamate |
| SMILES | C=CC(=O)C[C@H](OC1CCCCO1)[C@H](CC1CCCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H39NO5/c1-5-18(25)16-20(28-21-13-9-10-14-27-21)19(15-17-11-7-6-8-12-17)24-22(26)29-23(2,3)4/h5,17,19-21H,1,6-16H2,2-4H3,(H,24,26)/t19-,20-,21?/m0/s1 |
| InChIKey | DESOLJAKPQYTFI-AHTKWCMKSA-N |
| XLogP | 4.91 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|