C23H35FO5 — CID 10001608
7-[(1R,2R,3R,5S)-2-[(3R)-5-(3-fluorophenyl)-3-hydroxypentyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 10001608) has the molecular formula C23H35FO5 and a molecular weight of 410.53 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[(3R)-5-(3-fluorophenyl)-3-hydroxypentyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[(3R)-5-(3-fluorophenyl)-3-hydroxypentyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 10001608 |
| Molecular Formula | C23H35FO5 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[(3R)-5-(3-fluorophenyl)-3-hydroxypentyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1[C@@H](CC[C@@H](O)CCc2cccc(F)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H35FO5/c24-17-7-5-6-16(14-17)10-11-18(25)12-13-20-19(21(26)15-22(20)27)8-3-1-2-4-9-23(28)29/h5-7,14,18-22,25-27H,1-4,8-13,15H2,(H,28,29)/t18-,19+,20+,21-,22+/m0/s1 |
| InChIKey | YRTPAGJEAKGFJE-AHJNKEMKSA-N |
| XLogP | 3.68 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|