C23H42O4Si — CID 10001629
(E,2R,6R,8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-10-methylidene-7-oxododec-4-enoic acid (PubChem CID 10001629) has the molecular formula C23H42O4Si and a molecular weight of 410.67 g/mol. Its IUPAC name is (E,2R,6R,8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-10-methylidene-7-oxododec-4-enoic acid.
| Compound Name | (E,2R,6R,8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-10-methylidene-7-oxododec-4-enoic acid |
|---|---|
| PubChem CID | 10001629 |
| Molecular Formula | C23H42O4Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | (E,2R,6R,8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-10-methylidene-7-oxododec-4-enoic acid |
| SMILES | C=C(CC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)[C@H](C)/C=C(\C)C[C@@H](C)C(=O)O |
| InChI | InChI=1S/C23H42O4Si/c1-12-16(3)21(27-28(10,11)23(7,8)9)19(6)20(24)17(4)13-15(2)14-18(5)22(25)26/h13,17-19,21H,3,12,14H2,1-2,4-11H3,(H,25,26)/b15-13+/t17-,18-,19-,21-/m1/s1 |
| InChIKey | IGSIPNDFAZACJD-SHSVCAHGSA-N |
| XLogP | 6.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|