C22H24N2O6 — CID 10001697
(1S,2R,5S,6R)-2,5-bis(ethenyl)-1,6-bis(4-nitrophenyl)hexane-1,6-diol (PubChem CID 10001697) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is (1S,2R,5S,6R)-2,5-bis(ethenyl)-1,6-bis(4-nitrophenyl)hexane-1,6-diol.
| Compound Name | (1S,2R,5S,6R)-2,5-bis(ethenyl)-1,6-bis(4-nitrophenyl)hexane-1,6-diol |
|---|---|
| PubChem CID | 10001697 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (1S,2R,5S,6R)-2,5-bis(ethenyl)-1,6-bis(4-nitrophenyl)hexane-1,6-diol |
| SMILES | C=CC(CC[C@H](C=C)[C@H](O)c1ccc([N+](=O)[O-])cc1)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H24N2O6/c1-3-15(21(25)17-7-11-19(12-8-17)23(27)28)5-6-16(4-2)22(26)18-9-13-20(14-10-18)24(29)30/h3-4,7-16,21-22,25-26H,1-2,5-6H2/t15-,16?,21-,22+/m0/s1 |
| InChIKey | NUWYKPXELXZQMZ-ZEBIKNNBSA-N |
| XLogP | 4.65 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|