C25H26F3NO — CID 10001785
2-ethoxy-N-methyl-2-phenyl-N-[[4-[2-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine (PubChem CID 10001785) has the molecular formula C25H26F3NO and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-ethoxy-N-methyl-2-phenyl-N-[[4-[2-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine.
| Compound Name | 2-ethoxy-N-methyl-2-phenyl-N-[[4-[2-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 10001785 |
| Molecular Formula | C25H26F3NO |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-ethoxy-N-methyl-2-phenyl-N-[[4-[2-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine |
| SMILES | CCOC(CN(C)Cc1ccc(-c2ccccc2C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H26F3NO/c1-3-30-24(21-9-5-4-6-10-21)18-29(2)17-19-13-15-20(16-14-19)22-11-7-8-12-23(22)25(26,27)28/h4-16,24H,3,17-18H2,1-2H3 |
| InChIKey | ZLDKAXMNCHDELS-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |