C21H16F3N3O3 — CID 10001880
3-[1-(3-hydroxypropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-[2-(trifluoromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 10001880) has the molecular formula C21H16F3N3O3 and a molecular weight of 415.37 g/mol. Its IUPAC name is 3-[1-(3-hydroxypropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-[2-(trifluoromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-[1-(3-hydroxypropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-[2-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 10001880 |
| Molecular Formula | C21H16F3N3O3 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 3-[1-(3-hydroxypropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-[2-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CCCO)c3ncccc23)=C1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H16F3N3O3/c22-21(23,24)15-7-2-1-5-13(15)16-17(20(30)26-19(16)29)14-11-27(9-4-10-28)18-12(14)6-3-8-25-18/h1-3,5-8,11,28H,4,9-10H2,(H,26,29,30) |
| InChIKey | PLUWMEIYYZQPRH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|