C22H26ClN3OS — CID 10001928
N-[2-(1-benzylpiperidin-4-yl)ethylcarbamothioyl]-4-chlorobenzamide (PubChem CID 10001928) has the molecular formula C22H26ClN3OS and a molecular weight of 415.99 g/mol. Its IUPAC name is N-[2-(1-benzylpiperidin-4-yl)ethylcarbamothioyl]-4-chlorobenzamide.
| Compound Name | N-[2-(1-benzylpiperidin-4-yl)ethylcarbamothioyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 10001928 |
| Molecular Formula | C22H26ClN3OS |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-[2-(1-benzylpiperidin-4-yl)ethylcarbamothioyl]-4-chlorobenzamide |
| SMILES | O=C(NC(=S)NCCC1CCN(Cc2ccccc2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H26ClN3OS/c23-20-8-6-19(7-9-20)21(27)25-22(28)24-13-10-17-11-14-26(15-12-17)16-18-4-2-1-3-5-18/h1-9,17H,10-16H2,(H2,24,25,27,28) |
| InChIKey | LRESLIPVFHTRCL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|