About ethane-1,1,2-triamine
ethane-1,1,2-triamine (PubChem CID 10001931) has the molecular formula C2H9N3
and a molecular weight of 75.12 g/mol. Its IUPAC name is ethane-1,1,2-triamine.
Molecular Properties
| Compound Name | ethane-1,1,2-triamine |
| PubChem CID | 10001931 |
| Molecular Formula | C2H9N3 |
| Molecular Weight | 75.12 g/mol |
| Exact Mass | 75.08 |
| IUPAC Name | ethane-1,1,2-triamine |
| SMILES | NCC(N)N |
| InChI | InChI=1S/C2H9N3/c3-1-2(4)5/h2H,1,3-5H2 |
| InChIKey | PJMICNUGBHGMKQ-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 75.12 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,1,2-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,1,2-triamine?
The IUPAC name of ethane-1,1,2-triamine (CID 10001931) is ethane-1,1,2-triamine.
What is the SMILES notation for ethane-1,1,2-triamine?
The canonical SMILES for ethane-1,1,2-triamine is NCC(N)N.
What is the InChIKey of ethane-1,1,2-triamine?
The InChIKey is PJMICNUGBHGMKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H9N3/c3-1-2(4)5/h2H,1,3-5H2.
What are the key properties of ethane-1,1,2-triamine?
ethane-1,1,2-triamine has a molecular weight of 75.12 g/mol, XLogP of -1.81, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,1,2-triamine is sourced from PubChem (CID 10001931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).