C20H18BrNO4 — CID 10001933
4-(3-bromo-4,5-dimethoxyphenyl)-7-methyl-3,4-dihydropyrano[2,3-e]indol-2-one (PubChem CID 10001933) has the molecular formula C20H18BrNO4 and a molecular weight of 416.27 g/mol. Its IUPAC name is 4-(3-bromo-4,5-dimethoxyphenyl)-7-methyl-3,4-dihydropyrano[2,3-e]indol-2-one.
| Compound Name | 4-(3-bromo-4,5-dimethoxyphenyl)-7-methyl-3,4-dihydropyrano[2,3-e]indol-2-one |
|---|---|
| PubChem CID | 10001933 |
| Molecular Formula | C20H18BrNO4 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 4-(3-bromo-4,5-dimethoxyphenyl)-7-methyl-3,4-dihydropyrano[2,3-e]indol-2-one |
| SMILES | COc1cc(C2CC(=O)Oc3c2ccc2c3ccn2C)cc(Br)c1OC |
| InChI | InChI=1S/C20H18BrNO4/c1-22-7-6-13-16(22)5-4-12-14(10-18(23)26-19(12)13)11-8-15(21)20(25-3)17(9-11)24-2/h4-9,14H,10H2,1-3H3 |
| InChIKey | AZNFGTAIURQYKD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|