C16H18N4O3S2 — CID 1000196
2-[(4-methoxybenzoyl)carbamothioylamino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 1000196) has the molecular formula C16H18N4O3S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-[(4-methoxybenzoyl)carbamothioylamino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(4-methoxybenzoyl)carbamothioylamino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 1000196 |
| Molecular Formula | C16H18N4O3S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-[(4-methoxybenzoyl)carbamothioylamino]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2nc(C)c(C(=O)N(C)C)s2)cc1 |
| InChI | InChI=1S/C16H18N4O3S2/c1-9-12(14(22)20(2)3)25-16(17-9)19-15(24)18-13(21)10-5-7-11(23-4)8-6-10/h5-8H,1-4H3,(H2,17,18,19,21,24) |
| InChIKey | ZZJNUSLNHVOXKK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|