About (4-methylbenzoyl) 2-[(4-methylbenzoyl)amino]-5-nitrobenzoate
(4-methylbenzoyl) 2-[(4-methylbenzoyl)amino]-5-nitrobenzoate (PubChem CID 10002085) has the molecular formula C23H18N2O6
and a molecular weight of 418.41 g/mol. Its IUPAC name is (4-methylbenzoyl) 2-[(4-methylbenzoyl)amino]-5-nitrobenzoate.
Molecular Properties
| Compound Name | (4-methylbenzoyl) 2-[(4-methylbenzoyl)amino]-5-nitrobenzoate |
| PubChem CID | 10002085 |
| Molecular Formula | C23H18N2O6 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (4-methylbenzoyl) 2-[(4-methylbenzoyl)amino]-5-nitrobenzoate |
| SMILES | Cc1ccc(C(=O)Nc2ccc([N+](=O)[O-])cc2C(=O)OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H18N2O6/c1-14-3-7-16(8-4-14)21(26)24-20-12-11-18(25(29)30)13-19(20)23(28)31-22(27)17-9-5-15(2)6-10-17/h3-13H,1-2H3,(H,24,26) |
| InChIKey | QWDSBUBKMKAJDR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-methylbenzoyl) 2-[(4-methylbenzoyl)amino]-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylbenzoyl) 2-[(4-methylbenzoyl)amino]-5-nitrobenzoate?
The IUPAC name of (4-methylbenzoyl) 2-[(4-methylbenzoyl)amino]-5-nitrobenzoate (CID 10002085) is (4-methylbenzoyl) 2-[(4-methylbenzoyl)amino]-5-nitrobenzoate.
What is the SMILES notation for (4-methylbenzoyl) 2-[(4-methylbenzoyl)amino]-5-nitrobenzoate?
The canonical SMILES for (4-methylbenzoyl) 2-[(4-methylbenzoyl)amino]-5-nitrobenzoate is Cc1ccc(C(=O)Nc2ccc([N+](=O)[O-])cc2C(=O)OC(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of (4-methylbenzoyl) 2-[(4-methylbenzoyl)amino]-5-nitrobenzoate?
The InChIKey is QWDSBUBKMKAJDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2O6/c1-14-3-7-16(8-4-14)21(26)24-20-12-11-18(25(29)30)13-19(20)23(28)31-22(27)17-9-5-15(2)6-10-17/h3-13H,1-2H3,(H,24,26).
What are the key properties of (4-methylbenzoyl) 2-[(4-methylbenzoyl)amino]-5-nitrobenzoate?
(4-methylbenzoyl) 2-[(4-methylbenzoyl)amino]-5-nitrobenzoate has a molecular weight of 418.41 g/mol, XLogP of 4.46, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylbenzoyl) 2-[(4-methylbenzoyl)amino]-5-nitrobenzoate is sourced from PubChem (CID 10002085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).