C20H26FN5O4 — CID 10002154
1-ethyl-3-(2-fluoro-3,5-dimethoxyphenyl)-7-(4-hydroxybutylamino)-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 10002154) has the molecular formula C20H26FN5O4 and a molecular weight of 419.46 g/mol. Its IUPAC name is 1-ethyl-3-(2-fluoro-3,5-dimethoxyphenyl)-7-(4-hydroxybutylamino)-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 1-ethyl-3-(2-fluoro-3,5-dimethoxyphenyl)-7-(4-hydroxybutylamino)-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 10002154 |
| Molecular Formula | C20H26FN5O4 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-ethyl-3-(2-fluoro-3,5-dimethoxyphenyl)-7-(4-hydroxybutylamino)-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | CCN1C(=O)N(c2cc(OC)cc(OC)c2F)Cc2cnc(NCCCCO)nc21 |
| InChI | InChI=1S/C20H26FN5O4/c1-4-25-18-13(11-23-19(24-18)22-7-5-6-8-27)12-26(20(25)28)15-9-14(29-2)10-16(30-3)17(15)21/h9-11,27H,4-8,12H2,1-3H3,(H,22,23,24) |
| InChIKey | GYZGTFODSDPKKI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|