C26H24N4O2 — CID 10002471
3-[1-[3-(dimethylamino)propyl]pyrrolo[2,3-b]pyridin-3-yl]-4-naphthalen-1-ylpyrrole-2,5-dione (PubChem CID 10002471) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-[1-[3-(dimethylamino)propyl]pyrrolo[2,3-b]pyridin-3-yl]-4-naphthalen-1-ylpyrrole-2,5-dione.
| Compound Name | 3-[1-[3-(dimethylamino)propyl]pyrrolo[2,3-b]pyridin-3-yl]-4-naphthalen-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 10002471 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 3-[1-[3-(dimethylamino)propyl]pyrrolo[2,3-b]pyridin-3-yl]-4-naphthalen-1-ylpyrrole-2,5-dione |
| SMILES | CN(C)CCCn1cc(C2=C(c3cccc4ccccc34)C(=O)NC2=O)c2cccnc21 |
| InChI | InChI=1S/C26H24N4O2/c1-29(2)14-7-15-30-16-21(20-12-6-13-27-24(20)30)23-22(25(31)28-26(23)32)19-11-5-9-17-8-3-4-10-18(17)19/h3-6,8-13,16H,7,14-15H2,1-2H3,(H,28,31,32) |
| InChIKey | WLEWZWNDSXTRLZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|