About N'-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]morpholine-4-carboximidamide
N'-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]morpholine-4-carboximidamide (PubChem CID 10002476) has the molecular formula C22H24N4O3S
and a molecular weight of 424.53 g/mol. Its IUPAC name is N'-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]morpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N'-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]morpholine-4-carboximidamide |
| PubChem CID | 10002476 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N'-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]morpholine-4-carboximidamide |
| SMILES | COc1ccc(-c2nc(/N=C(\N)N3CCOCC3)sc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H24N4O3S/c1-27-17-7-3-15(4-8-17)19-20(16-5-9-18(28-2)10-6-16)30-22(24-19)25-21(23)26-11-13-29-14-12-26/h3-10H,11-14H2,1-2H3,(H2,23,24,25) |
| InChIKey | FHKJNKRUSQVUPM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]morpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]morpholine-4-carboximidamide?
The IUPAC name of N'-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]morpholine-4-carboximidamide (CID 10002476) is N'-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]morpholine-4-carboximidamide.
What is the SMILES notation for N'-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]morpholine-4-carboximidamide?
The canonical SMILES for N'-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]morpholine-4-carboximidamide is COc1ccc(-c2nc(/N=C(\N)N3CCOCC3)sc2-c2ccc(OC)cc2)cc1.
What is the InChIKey of N'-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]morpholine-4-carboximidamide?
The InChIKey is FHKJNKRUSQVUPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4O3S/c1-27-17-7-3-15(4-8-17)19-20(16-5-9-18(28-2)10-6-16)30-22(24-19)25-21(23)26-11-13-29-14-12-26/h3-10H,11-14H2,1-2H3,(H2,23,24,25).
What are the key properties of N'-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]morpholine-4-carboximidamide?
N'-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]morpholine-4-carboximidamide has a molecular weight of 424.53 g/mol, XLogP of 3.77, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]morpholine-4-carboximidamide is sourced from PubChem (CID 10002476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).