C22H28N6OS — CID 10002486
1-[4-[4-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]propan-2-ol (PubChem CID 10002486) has the molecular formula C22H28N6OS and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-[4-[4-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]propan-2-ol.
| Compound Name | 1-[4-[4-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 10002486 |
| Molecular Formula | C22H28N6OS |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 1-[4-[4-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]propan-2-ol |
| SMILES | Cc1nc(C)c(-c2ccnc(Nc3ccc(N4CCN(CC(C)O)CC4)cc3)n2)s1 |
| InChI | InChI=1S/C22H28N6OS/c1-15(29)14-27-10-12-28(13-11-27)19-6-4-18(5-7-19)25-22-23-9-8-20(26-22)21-16(2)24-17(3)30-21/h4-9,15,29H,10-14H2,1-3H3,(H,23,25,26) |
| InChIKey | XNAIROZOQQAQJL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|