C26H27N5O — CID 10002537
2-[4-[2-(N-benzylanilino)acetyl]piperazin-1-yl]-2-pyridin-3-ylacetonitrile (PubChem CID 10002537) has the molecular formula C26H27N5O and a molecular weight of 425.54 g/mol. Its IUPAC name is 2-[4-[2-(N-benzylanilino)acetyl]piperazin-1-yl]-2-pyridin-3-ylacetonitrile.
| Compound Name | 2-[4-[2-(N-benzylanilino)acetyl]piperazin-1-yl]-2-pyridin-3-ylacetonitrile |
|---|---|
| PubChem CID | 10002537 |
| Molecular Formula | C26H27N5O |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-[4-[2-(N-benzylanilino)acetyl]piperazin-1-yl]-2-pyridin-3-ylacetonitrile |
| SMILES | N#CC(c1cccnc1)N1CCN(C(=O)CN(Cc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H27N5O/c27-18-25(23-10-7-13-28-19-23)29-14-16-30(17-15-29)26(32)21-31(24-11-5-2-6-12-24)20-22-8-3-1-4-9-22/h1-13,19,25H,14-17,20-21H2 |
| InChIKey | YKMHEHAOJMCWKJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 63.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |