About (2S)-2-[[6-[4-[(3,5-difluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]hexanoic acid
(2S)-2-[[6-[4-[(3,5-difluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]hexanoic acid (PubChem CID 10002628) has the molecular formula C23H23F2N3O3
and a molecular weight of 427.45 g/mol. Its IUPAC name is (2S)-2-[[6-[4-[(3,5-difluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]hexanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[[6-[4-[(3,5-difluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]hexanoic acid |
| PubChem CID | 10002628 |
| Molecular Formula | C23H23F2N3O3 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | (2S)-2-[[6-[4-[(3,5-difluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]hexanoic acid |
| SMILES | CCCC[C@H](Nc1cc(-c2ccc(OCc3cc(F)cc(F)c3)cc2)ncn1)C(=O)O |
| InChI | InChI=1S/C23H23F2N3O3/c1-2-3-4-20(23(29)30)28-22-12-21(26-14-27-22)16-5-7-19(8-6-16)31-13-15-9-17(24)11-18(25)10-15/h5-12,14,20H,2-4,13H2,1H3,(H,29,30)(H,26,27,28)/t20-/m0/s1 |
| InChIKey | BAXFDSRVKTZJDJ-FQEVSTJZSA-N |
| XLogP | 5.06 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-[[6-[4-[(3,5-difluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[6-[4-[(3,5-difluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]hexanoic acid?
The IUPAC name of (2S)-2-[[6-[4-[(3,5-difluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]hexanoic acid (CID 10002628) is (2S)-2-[[6-[4-[(3,5-difluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]hexanoic acid.
What is the SMILES notation for (2S)-2-[[6-[4-[(3,5-difluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]hexanoic acid?
The canonical SMILES for (2S)-2-[[6-[4-[(3,5-difluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]hexanoic acid is CCCC[C@H](Nc1cc(-c2ccc(OCc3cc(F)cc(F)c3)cc2)ncn1)C(=O)O.
What is the InChIKey of (2S)-2-[[6-[4-[(3,5-difluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]hexanoic acid?
The InChIKey is BAXFDSRVKTZJDJ-FQEVSTJZSA-N. The full InChI is InChI=1S/C23H23F2N3O3/c1-2-3-4-20(23(29)30)28-22-12-21(26-14-27-22)16-5-7-19(8-6-16)31-13-15-9-17(24)11-18(25)10-15/h5-12,14,20H,2-4,13H2,1H3,(H,29,30)(H,26,27,28)/t20-/m0/s1.
What are the key properties of (2S)-2-[[6-[4-[(3,5-difluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]hexanoic acid?
(2S)-2-[[6-[4-[(3,5-difluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]hexanoic acid has a molecular weight of 427.45 g/mol, XLogP of 5.06, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[6-[4-[(3,5-difluorophenyl)methoxy]phenyl]pyrimidin-4-yl]amino]hexanoic acid is sourced from PubChem (CID 10002628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).