C20H16N2O3S3 — CID 10002690
(5Z)-5-[[4-(2-phenylsulfanylacetyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 10002690) has the molecular formula C20H16N2O3S3 and a molecular weight of 428.56 g/mol. Its IUPAC name is (5Z)-5-[[4-(2-phenylsulfanylacetyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(2-phenylsulfanylacetyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10002690 |
| Molecular Formula | C20H16N2O3S3 |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | (5Z)-5-[[4-(2-phenylsulfanylacetyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1ccc2c(c1)N(C(=O)CSc1ccccc1)CCO2 |
| InChI | InChI=1S/C20H16N2O3S3/c23-18(12-27-14-4-2-1-3-5-14)22-8-9-25-16-7-6-13(10-15(16)22)11-17-19(24)21-20(26)28-17/h1-7,10-11H,8-9,12H2,(H,21,24,26)/b17-11- |
| InChIKey | LYJCNRVAIPWBKM-BOPFTXTBSA-N |
| XLogP | 3.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|