About 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-(4-fluorophenyl)thiourea
1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-(4-fluorophenyl)thiourea (PubChem CID 1000301) has the molecular formula C15H17BrFN5OS
and a molecular weight of 414.30 g/mol. Its IUPAC name is 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-(4-fluorophenyl)thiourea.
Molecular Properties
| Compound Name | 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-(4-fluorophenyl)thiourea |
| PubChem CID | 1000301 |
| Molecular Formula | C15H17BrFN5OS |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-(4-fluorophenyl)thiourea |
| SMILES | Cc1nn(CCC(=O)NNC(=S)Nc2ccc(F)cc2)c(C)c1Br |
| InChI | InChI=1S/C15H17BrFN5OS/c1-9-14(16)10(2)22(21-9)8-7-13(23)19-20-15(24)18-12-5-3-11(17)4-6-12/h3-6H,7-8H2,1-2H3,(H,19,23)(H2,18,20,24) |
| InChIKey | HKRIRQZBPUMRDO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-(4-fluorophenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-(4-fluorophenyl)thiourea?
The IUPAC name of 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-(4-fluorophenyl)thiourea (CID 1000301) is 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-(4-fluorophenyl)thiourea.
What is the SMILES notation for 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-(4-fluorophenyl)thiourea?
The canonical SMILES for 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-(4-fluorophenyl)thiourea is Cc1nn(CCC(=O)NNC(=S)Nc2ccc(F)cc2)c(C)c1Br.
What is the InChIKey of 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-(4-fluorophenyl)thiourea?
The InChIKey is HKRIRQZBPUMRDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17BrFN5OS/c1-9-14(16)10(2)22(21-9)8-7-13(23)19-20-15(24)18-12-5-3-11(17)4-6-12/h3-6H,7-8H2,1-2H3,(H,19,23)(H2,18,20,24).
What are the key properties of 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-(4-fluorophenyl)thiourea?
1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-(4-fluorophenyl)thiourea has a molecular weight of 414.30 g/mol, XLogP of 2.81, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-(4-fluorophenyl)thiourea is sourced from PubChem (CID 1000301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).