C20H23F2N5O2S — CID 10003097
4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-[(E)-6-(2H-tetrazol-5-yl)hex-2-enyl]-1,3-thiazolidin-2-one (PubChem CID 10003097) has the molecular formula C20H23F2N5O2S and a molecular weight of 435.50 g/mol. Its IUPAC name is 4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-[(E)-6-(2H-tetrazol-5-yl)hex-2-enyl]-1,3-thiazolidin-2-one.
| Compound Name | 4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-[(E)-6-(2H-tetrazol-5-yl)hex-2-enyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 10003097 |
| Molecular Formula | C20H23F2N5O2S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-[(E)-6-(2H-tetrazol-5-yl)hex-2-enyl]-1,3-thiazolidin-2-one |
| SMILES | O=C1SCC(/C=C/C(O)C(F)(F)c2ccccc2)N1C/C=C/CCCc1nn[nH]n1 |
| InChI | InChI=1S/C20H23F2N5O2S/c21-20(22,15-8-4-3-5-9-15)17(28)12-11-16-14-30-19(29)27(16)13-7-2-1-6-10-18-23-25-26-24-18/h2-5,7-9,11-12,16-17,28H,1,6,10,13-14H2,(H,23,24,25,26)/b7-2+,12-11+ |
| InChIKey | QDAWEHCNNMEAKU-WTWWLZGVSA-N |
| XLogP | 3.33 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|