C23H33NO5S — CID 10003118
4-[2-[(2R)-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid (PubChem CID 10003118) has the molecular formula C23H33NO5S and a molecular weight of 435.59 g/mol. Its IUPAC name is 4-[2-[(2R)-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid.
| Compound Name | 4-[2-[(2R)-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 10003118 |
| Molecular Formula | C23H33NO5S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 4-[2-[(2R)-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid |
| SMILES | COCc1cccc(C[C@H](O)/C=C/[C@H]2CCCC(=O)N2CCSCCCC(=O)O)c1 |
| InChI | InChI=1S/C23H33NO5S/c1-29-17-19-6-2-5-18(15-19)16-21(25)11-10-20-7-3-8-22(26)24(20)12-14-30-13-4-9-23(27)28/h2,5-6,10-11,15,20-21,25H,3-4,7-9,12-14,16-17H2,1H3,(H,27,28)/b11-10+/t20-,21-/m1/s1 |
| InChIKey | KUQBIVNMUSAYOR-VRDGUJSXSA-N |
| XLogP | 3.27 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|