C23H16Cl2N2OS — CID 10003292
2-(3,4-dichlorophenyl)-3-(2-phenyl-1H-indol-3-yl)-1,3-thiazolidin-4-one (PubChem CID 10003292) has the molecular formula C23H16Cl2N2OS and a molecular weight of 439.37 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-3-(2-phenyl-1H-indol-3-yl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(3,4-dichlorophenyl)-3-(2-phenyl-1H-indol-3-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10003292 |
| Molecular Formula | C23H16Cl2N2OS |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-3-(2-phenyl-1H-indol-3-yl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccc(Cl)c(Cl)c2)N1c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C23H16Cl2N2OS/c24-17-11-10-15(12-18(17)25)23-27(20(28)13-29-23)22-16-8-4-5-9-19(16)26-21(22)14-6-2-1-3-7-14/h1-12,23,26H,13H2 |
| InChIKey | DOHPRXRERPIXMW-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |