About 5-{4-[6-fluoro-1-(2-methoxyethyl)-1H-indol-3-yl]piperidin-1-ylmethyl}-2-methoxybenzoic acid
5-{4-[6-fluoro-1-(2-methoxyethyl)-1H-indol-3-yl]piperidin-1-ylmethyl}-2-methoxybenzoic acid (PubChem CID 10003369) has the molecular formula C25H29FN2O4
and a molecular weight of 440.50 g/mol. Its IUPAC name is 5-[[4-[6-fluoro-1-(2-methoxyethyl)indol-3-yl]piperidin-1-yl]methyl]-2-methoxybenzoic acid.
Molecular Properties
| Compound Name | 5-{4-[6-fluoro-1-(2-methoxyethyl)-1H-indol-3-yl]piperidin-1-ylmethyl}-2-methoxybenzoic acid |
| PubChem CID | 10003369 |
| Molecular Formula | C25H29FN2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 5-[[4-[6-fluoro-1-(2-methoxyethyl)indol-3-yl]piperidin-1-yl]methyl]-2-methoxybenzoic acid |
| SMILES | COCCN1C=C(C2=C1C=C(C=C2)F)C3CCN(CC3)CC4=CC(=C(C=C4)OC)C(=O)O |
| InChI | InChI=1S/C25H29FN2O4/c1-31-12-11-28-16-22(20-5-4-19(26)14-23(20)28)18-7-9-27(10-8-18)15-17-3-6-24(32-2)21(13-17)25(29)30/h3-6,13-14,16,18H,7-12,15H2,1-2H3,(H,29,30) |
| InChIKey | FLBZQKOWWVQHOV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 63.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | 615 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-{4-[6-fluoro-1-(2-methoxyethyl)-1H-indol-3-yl]piperidin-1-ylmethyl}-2-methoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-{4-[6-fluoro-1-(2-methoxyethyl)-1H-indol-3-yl]piperidin-1-ylmethyl}-2-methoxybenzoic acid?
The IUPAC name of 5-{4-[6-fluoro-1-(2-methoxyethyl)-1H-indol-3-yl]piperidin-1-ylmethyl}-2-methoxybenzoic acid (CID 10003369) is 5-[[4-[6-fluoro-1-(2-methoxyethyl)indol-3-yl]piperidin-1-yl]methyl]-2-methoxybenzoic acid.
What is the SMILES notation for 5-{4-[6-fluoro-1-(2-methoxyethyl)-1H-indol-3-yl]piperidin-1-ylmethyl}-2-methoxybenzoic acid?
The canonical SMILES for 5-{4-[6-fluoro-1-(2-methoxyethyl)-1H-indol-3-yl]piperidin-1-ylmethyl}-2-methoxybenzoic acid is COCCN1C=C(C2=C1C=C(C=C2)F)C3CCN(CC3)CC4=CC(=C(C=C4)OC)C(=O)O.
What is the InChIKey of 5-{4-[6-fluoro-1-(2-methoxyethyl)-1H-indol-3-yl]piperidin-1-ylmethyl}-2-methoxybenzoic acid?
The InChIKey is FLBZQKOWWVQHOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29FN2O4/c1-31-12-11-28-16-22(20-5-4-19(26)14-23(20)28)18-7-9-27(10-8-18)15-17-3-6-24(32-2)21(13-17)25(29)30/h3-6,13-14,16,18H,7-12,15H2,1-2H3,(H,29,30).
What are the key properties of 5-{4-[6-fluoro-1-(2-methoxyethyl)-1H-indol-3-yl]piperidin-1-ylmethyl}-2-methoxybenzoic acid?
5-{4-[6-fluoro-1-(2-methoxyethyl)-1H-indol-3-yl]piperidin-1-ylmethyl}-2-methoxybenzoic acid has a molecular weight of 440.50 g/mol, XLogP of 1.20, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-{4-[6-fluoro-1-(2-methoxyethyl)-1H-indol-3-yl]piperidin-1-ylmethyl}-2-methoxybenzoic acid is sourced from PubChem (CID 10003369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).