C19H34F2N2O5S — CID 10003382
(2S,4R)-4-(3,3-difluoropropyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide (PubChem CID 10003382) has the molecular formula C19H34F2N2O5S and a molecular weight of 440.55 g/mol. Its IUPAC name is (2S,4R)-4-(3,3-difluoropropyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide.
| Compound Name | (2S,4R)-4-(3,3-difluoropropyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 10003382 |
| Molecular Formula | C19H34F2N2O5S |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (2S,4R)-4-(3,3-difluoropropyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide |
| SMILES | CS[C@H]1O[C@H]([C@H](NC(=O)[C@@H]2C[C@H](CCC(F)F)CCN2)C(C)C)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H34F2N2O5S/c1-9(2)13(17-15(25)14(24)16(26)19(28-17)29-3)23-18(27)11-8-10(6-7-22-11)4-5-12(20)21/h9-17,19,22,24-26H,4-8H2,1-3H3,(H,23,27)/t10-,11+,13-,14+,15-,16-,17-,19-/m1/s1 |
| InChIKey | MEWAKMMPJGCDCV-LFVVFAJESA-N |
| XLogP | 0.71 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |