C21H46O4Si3 — CID 10003725
trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexan-1-one (PubChem CID 10003725) has the molecular formula C21H46O4Si3 and a molecular weight of 446.85 g/mol. Its IUPAC name is trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexan-1-one.
| Compound Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexan-1-one |
|---|---|
| PubChem CID | 10003725 |
| Molecular Formula | C21H46O4Si3 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C21H46O4Si3/c1-20(2,3)27(10,11)23-17-14-16(22)15-18(19(17)25-26(7,8)9)24-28(12,13)21(4,5)6/h17-19H,14-15H2,1-13H3/t17-,18-/m1/s1 |
| InChIKey | GAXPOBFIIBZPRB-QZTJIDSGSA-N |
| XLogP | 6.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|