C20H27N5O7 — CID 10003846
methyl (2S,4S)-1-[(2R)-2-(4-nitroimidazol-1-yl)octanoyl]-4-(1,2-oxazol-5-yloxy)pyrrolidine-2-carboxylate (PubChem CID 10003846) has the molecular formula C20H27N5O7 and a molecular weight of 449.46 g/mol. Its IUPAC name is methyl (2S,4S)-1-[(2R)-2-(4-nitroimidazol-1-yl)octanoyl]-4-(1,2-oxazol-5-yloxy)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-1-[(2R)-2-(4-nitroimidazol-1-yl)octanoyl]-4-(1,2-oxazol-5-yloxy)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10003846 |
| Molecular Formula | C20H27N5O7 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | methyl (2S,4S)-1-[(2R)-2-(4-nitroimidazol-1-yl)octanoyl]-4-(1,2-oxazol-5-yloxy)pyrrolidine-2-carboxylate |
| SMILES | CCCCCC[C@H](C(=O)N1C[C@@H](Oc2ccno2)C[C@H]1C(=O)OC)n1cnc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H27N5O7/c1-3-4-5-6-7-15(23-12-17(21-13-23)25(28)29)19(26)24-11-14(10-16(24)20(27)30-2)31-18-8-9-22-32-18/h8-9,12-16H,3-7,10-11H2,1-2H3/t14-,15+,16-/m0/s1 |
| InChIKey | MAFHJWLPFVZRJM-XHSDSOJGSA-N |
| XLogP | 2.51 |
| TPSA | 142.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|