C23H38N4O5 — CID 10003908
(E)-N-[(3S,7S,10S)-3-butan-2-yl-7-methyl-2,5,6,9-tetraoxo-1,4,8-triazacyclotridec-10-yl]-6-methylhept-2-enamide (PubChem CID 10003908) has the molecular formula C23H38N4O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is (E)-N-[(3S,7S,10S)-3-butan-2-yl-7-methyl-2,5,6,9-tetraoxo-1,4,8-triazacyclotridec-10-yl]-6-methylhept-2-enamide.
| Compound Name | (E)-N-[(3S,7S,10S)-3-butan-2-yl-7-methyl-2,5,6,9-tetraoxo-1,4,8-triazacyclotridec-10-yl]-6-methylhept-2-enamide |
|---|---|
| PubChem CID | 10003908 |
| Molecular Formula | C23H38N4O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | (E)-N-[(3S,7S,10S)-3-butan-2-yl-7-methyl-2,5,6,9-tetraoxo-1,4,8-triazacyclotridec-10-yl]-6-methylhept-2-enamide |
| SMILES | CCC(C)[C@@H]1NC(=O)C(=O)[C@H](C)NC(=O)[C@@H](NC(=O)/C=C/CCC(C)C)CCCNC1=O |
| InChI | InChI=1S/C23H38N4O5/c1-6-15(4)19-22(31)24-13-9-11-17(26-18(28)12-8-7-10-14(2)3)21(30)25-16(5)20(29)23(32)27-19/h8,12,14-17,19H,6-7,9-11,13H2,1-5H3,(H,24,31)(H,25,30)(H,26,28)(H,27,32)/b12-8+/t15?,16-,17-,19-/m0/s1 |
| InChIKey | RMXQEJCLTAHJSJ-YZKPJGCGSA-N |
| XLogP | 0.98 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|