C22H21N5O6 — CID 10003945
1-[6-[[2-(2-hydroxyethyl)-1-oxo-3H-isoindol-5-yl]oxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione (PubChem CID 10003945) has the molecular formula C22H21N5O6 and a molecular weight of 451.44 g/mol. Its IUPAC name is 1-[6-[[2-(2-hydroxyethyl)-1-oxo-3H-isoindol-5-yl]oxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 1-[6-[[2-(2-hydroxyethyl)-1-oxo-3H-isoindol-5-yl]oxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 10003945 |
| Molecular Formula | C22H21N5O6 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 1-[6-[[2-(2-hydroxyethyl)-1-oxo-3H-isoindol-5-yl]oxy]-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
| SMILES | O=C1NC(=O)C2(CCCN2c2ccc(Oc3ccc4c(c3)CN(CCO)C4=O)nc2)C(=O)N1 |
| InChI | InChI=1S/C22H21N5O6/c28-9-8-26-12-13-10-15(3-4-16(13)18(26)29)33-17-5-2-14(11-23-17)27-7-1-6-22(27)19(30)24-21(32)25-20(22)31/h2-5,10-11,28H,1,6-9,12H2,(H2,24,25,30,31,32) |
| InChIKey | GRCWMPDRASCHHD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 141.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|