About dimethyl 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]propanedioate
dimethyl 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]propanedioate (PubChem CID 10003988) has the molecular formula C23H17FN2O7
and a molecular weight of 452.39 g/mol. Its IUPAC name is dimethyl 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]propanedioate |
| PubChem CID | 10003988 |
| Molecular Formula | C23H17FN2O7 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | dimethyl 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)c1c2c(c(O)c3ncccc13)C(=O)N(Cc1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C23H17FN2O7/c1-32-22(30)17(23(31)33-2)14-13-4-3-9-25-18(13)19(27)16-15(14)20(28)26(21(16)29)10-11-5-7-12(24)8-6-11/h3-9,17,27H,10H2,1-2H3 |
| InChIKey | RHYWDJJVYXUSDR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]propanedioate?
The IUPAC name of dimethyl 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]propanedioate (CID 10003988) is dimethyl 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]propanedioate.
What is the SMILES notation for dimethyl 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]propanedioate?
The canonical SMILES for dimethyl 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]propanedioate is COC(=O)C(C(=O)OC)c1c2c(c(O)c3ncccc13)C(=O)N(Cc1ccc(F)cc1)C2=O.
What is the InChIKey of dimethyl 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]propanedioate?
The InChIKey is RHYWDJJVYXUSDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17FN2O7/c1-32-22(30)17(23(31)33-2)14-13-4-3-9-25-18(13)19(27)16-15(14)20(28)26(21(16)29)10-11-5-7-12(24)8-6-11/h3-9,17,27H,10H2,1-2H3.
What are the key properties of dimethyl 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]propanedioate?
dimethyl 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]propanedioate has a molecular weight of 452.39 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]propanedioate is sourced from PubChem (CID 10003988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).