About 2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol
2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol (PubChem CID 10004010) has the molecular formula C29H28N2O3
and a molecular weight of 452.55 g/mol. Its IUPAC name is 2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol.
Molecular Properties
| Compound Name | 2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol |
| PubChem CID | 10004010 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol |
| SMILES | COc1c(CC=C(C)C)c(-c2c[nH]c3ccccc23)c(OC)c(O)c1-c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H28N2O3/c1-17(2)13-14-20-25(21-15-30-23-11-7-5-9-18(21)23)29(34-4)27(32)26(28(20)33-3)22-16-31-24-12-8-6-10-19(22)24/h5-13,15-16,30-32H,14H2,1-4H3 |
| InChIKey | YVQFFNCNPFQQKW-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 70.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol?
The IUPAC name of 2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol (CID 10004010) is 2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol.
What is the SMILES notation for 2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol?
The canonical SMILES for 2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol is COc1c(CC=C(C)C)c(-c2c[nH]c3ccccc23)c(OC)c(O)c1-c1c[nH]c2ccccc12.
What is the InChIKey of 2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol?
The InChIKey is YVQFFNCNPFQQKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H28N2O3/c1-17(2)13-14-20-25(21-15-30-23-11-7-5-9-18(21)23)29(34-4)27(32)26(28(20)33-3)22-16-31-24-12-8-6-10-19(22)24/h5-13,15-16,30-32H,14H2,1-4H3.
What are the key properties of 2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol?
2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol has a molecular weight of 452.55 g/mol, XLogP of 7.21, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(1H-indol-3-yl)-3,6-dimethoxy-4-(3-methylbut-2-enyl)phenol is sourced from PubChem (CID 10004010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).