C22H21BrN4O2 — CID 10004038
2-[4-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-[(4-methoxyphenyl)methyl]ethanamine (PubChem CID 10004038) has the molecular formula C22H21BrN4O2 and a molecular weight of 453.34 g/mol. Its IUPAC name is 2-[4-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-[(4-methoxyphenyl)methyl]ethanamine.
| Compound Name | 2-[4-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-[(4-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 10004038 |
| Molecular Formula | C22H21BrN4O2 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 2-[4-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-[(4-methoxyphenyl)methyl]ethanamine |
| SMILES | COc1ccc(CNCCOc2ccc(-c3nc4ncc(Br)cc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C22H21BrN4O2/c1-28-18-6-2-15(3-7-18)13-24-10-11-29-19-8-4-16(5-9-19)21-26-20-12-17(23)14-25-22(20)27-21/h2-9,12,14,24H,10-11,13H2,1H3,(H,25,26,27) |
| InChIKey | GUGYHMCGSUBYSF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|