C23H26N4O4S — CID 10004106
6-(2-methoxyethoxy)-N,N-dimethyl-3-[(4R)-2-pyridin-3-yl-1,3-thiazolidine-4-carbonyl]indole-1-carboxamide (PubChem CID 10004106) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is 6-(2-methoxyethoxy)-N,N-dimethyl-3-[(4R)-2-pyridin-3-yl-1,3-thiazolidine-4-carbonyl]indole-1-carboxamide.
| Compound Name | 6-(2-methoxyethoxy)-N,N-dimethyl-3-[(4R)-2-pyridin-3-yl-1,3-thiazolidine-4-carbonyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 10004106 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 6-(2-methoxyethoxy)-N,N-dimethyl-3-[(4R)-2-pyridin-3-yl-1,3-thiazolidine-4-carbonyl]indole-1-carboxamide |
| SMILES | COCCOc1ccc2c(C(=O)[C@@H]3CSC(c4cccnc4)N3)cn(C(=O)N(C)C)c2c1 |
| InChI | InChI=1S/C23H26N4O4S/c1-26(2)23(29)27-13-18(17-7-6-16(11-20(17)27)31-10-9-30-3)21(28)19-14-32-22(25-19)15-5-4-8-24-12-15/h4-8,11-13,19,22,25H,9-10,14H2,1-3H3/t19-,22?/m0/s1 |
| InChIKey | UCRIDOFBRIHGSQ-YDNXMHBPSA-N |
| XLogP | 3.18 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|