C29H42O4 — CID 10004120
(4aR,6aR,6aS,6bS,8aR,12aS)-2,2,6b,9,9,12a-hexamethyl-10,13-dioxo-3,4,5,6,6a,6a,7,8,8a,14,14a,14b-dodecahydro-1H-picene-4a-carboxylic acid (PubChem CID 10004120) has the molecular formula C29H42O4 and a molecular weight of 454.65 g/mol. Its IUPAC name is (4aR,6aR,6aS,6bS,8aR,12aS)-2,2,6b,9,9,12a-hexamethyl-10,13-dioxo-3,4,5,6,6a,6a,7,8,8a,14,14a,14b-dodecahydro-1H-picene-4a-carboxylic acid.
| Compound Name | (4aR,6aR,6aS,6bS,8aR,12aS)-2,2,6b,9,9,12a-hexamethyl-10,13-dioxo-3,4,5,6,6a,6a,7,8,8a,14,14a,14b-dodecahydro-1H-picene-4a-carboxylic acid |
|---|---|
| PubChem CID | 10004120 |
| Molecular Formula | C29H42O4 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | (4aR,6aR,6aS,6bS,8aR,12aS)-2,2,6b,9,9,12a-hexamethyl-10,13-dioxo-3,4,5,6,6a,6a,7,8,8a,14,14a,14b-dodecahydro-1H-picene-4a-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C(=O)O)CC[C@@H]3C(CC(=O)[C@@H]4[C@@]5(C)C=CC(=O)C(C)(C)[C@@H]5CC[C@@]34C)C2C1 |
| InChI | InChI=1S/C29H42O4/c1-25(2)13-14-29(24(32)33)12-7-18-17(19(29)16-25)15-20(30)23-27(18,5)10-8-21-26(3,4)22(31)9-11-28(21,23)6/h9,11,17-19,21,23H,7-8,10,12-16H2,1-6H3,(H,32,33)/t17?,18-,19?,21+,23+,27+,28+,29-/m1/s1 |
| InChIKey | JPYLLQBCCBAHHR-MSCHKKJXSA-N |
| XLogP | 6.09 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |