C21H22F3NO5S — CID 10004263
N-hydroxy-4-[4-[4-(3,3,3-trifluoropropyl)phenyl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 10004263) has the molecular formula C21H22F3NO5S and a molecular weight of 457.47 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-(3,3,3-trifluoropropyl)phenyl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[4-(3,3,3-trifluoropropyl)phenyl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 10004263 |
| Molecular Formula | C21H22F3NO5S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N-hydroxy-4-[4-[4-(3,3,3-trifluoropropyl)phenyl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)F)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C21H22F3NO5S/c22-21(23,24)10-9-15-1-3-16(4-2-15)17-5-7-18(8-6-17)31(28,29)20(19(26)25-27)11-13-30-14-12-20/h1-8,27H,9-14H2,(H,25,26) |
| InChIKey | XGUWUPUDOPSHOW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|