C16H16F3N5S — CID 1000431
4-(4-ethylphenyl)-3-[[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 1000431) has the molecular formula C16H16F3N5S and a molecular weight of 367.40 g/mol. Its IUPAC name is 4-(4-ethylphenyl)-3-[[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(4-ethylphenyl)-3-[[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 1000431 |
| Molecular Formula | C16H16F3N5S |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 4-(4-ethylphenyl)-3-[[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1ccc(-n2c(Cn3nc(C(F)(F)F)cc3C)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C16H16F3N5S/c1-3-11-4-6-12(7-5-11)24-14(20-21-15(24)25)9-23-10(2)8-13(22-23)16(17,18)19/h4-8H,3,9H2,1-2H3,(H,21,25) |
| InChIKey | MMDRUAYDQKRTRA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|